ChemNet > CAS > 118337-33-0 2-broom-1-(3-methylbenzo[b]thiofeen-2-yl)ethan-1-on
118337-33-0 2-broom-1-(3-methylbenzo[b]thiofeen-2-yl)ethan-1-on
| Naam product |
2-broom-1-(3-methylbenzo[b]thiofeen-2-yl)ethan-1-on |
| Synoniemen |
2-broom-1-(3-methyl-1-benzothiofeen-2-yl)ethanon; 2-broom-1-(5-chloor-3-methyl-1-benzothiofeen-2-yl)ethanon |
| Engelse naam |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one;2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| MF |
C11H8BrClOS |
| Molecuulgewicht |
303.6026 |
| InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| CAS-nummer |
118337-33-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.632g/cm3 |
| Smeltpunt |
94℃ |
| Kookpunt |
396.2°C at 760 mmHg |
| Brekingsindex |
1.676 |
| Vlampunt |
193.4°C |
| Dampdruk |
1.73E-06mmHg at 25°C |
| Gevaarsymbolen |
C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|